C21H30N2O2Si2 — CID 67079769
2-[3-[bis(trimethylsilyl)amino]propyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 67079769) has the molecular formula C21H30N2O2Si2 and a molecular weight of 398.66 g/mol. Its IUPAC name is 2-[3-[bis(trimethylsilyl)amino]propyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[3-[bis(trimethylsilyl)amino]propyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 67079769 |
| Molecular Formula | C21H30N2O2Si2 |
| Molecular Weight | 398.66 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 2-[3-[bis(trimethylsilyl)amino]propyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | C[Si](C)(C)N(CCCN1C(=O)c2cccc3cccc(c23)C1=O)[Si](C)(C)C |
| InChI | InChI=1S/C21H30N2O2Si2/c1-26(2,3)23(27(4,5)6)15-9-14-22-20(24)17-12-7-10-16-11-8-13-18(19(16)17)21(22)25/h7-8,10-13H,9,14-15H2,1-6H3 |
| InChIKey | CQFNYJIVQQBWCA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.66 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|