C21H22N2O7S — CID 66826565
2-(4-methoxy-N-methylsulfonylanilino)-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoic acid (PubChem CID 66826565) has the molecular formula C21H22N2O7S and a molecular weight of 446.48 g/mol. Its IUPAC name is 2-(4-methoxy-N-methylsulfonylanilino)-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoic acid.
| Compound Name | 2-(4-methoxy-N-methylsulfonylanilino)-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoic acid |
|---|---|
| PubChem CID | 66826565 |
| Molecular Formula | C21H22N2O7S |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 2-(4-methoxy-N-methylsulfonylanilino)-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoic acid |
| SMILES | COc1ccc(N(C(CCN2C(=O)c3ccc(C)cc3C2=O)C(=O)O)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H22N2O7S/c1-13-4-9-16-17(12-13)20(25)22(19(16)24)11-10-18(21(26)27)23(31(3,28)29)14-5-7-15(30-2)8-6-14/h4-9,12,18H,10-11H2,1-3H3,(H,26,27) |
| InChIKey | PDYFORNJQRVSAT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|