C32H35NO6 — CID 66676457
2-[2-(5-tert-butyl-1,3-dioxoisoindol-2-yl)ethyl]-3-hydroxy-5-[4-(4-methoxyphenyl)phenyl]pentanoic acid (PubChem CID 66676457) has the molecular formula C32H35NO6 and a molecular weight of 529.63 g/mol. Its IUPAC name is 2-[2-(5-tert-butyl-1,3-dioxoisoindol-2-yl)ethyl]-3-hydroxy-5-[4-(4-methoxyphenyl)phenyl]pentanoic acid.
| Compound Name | 2-[2-(5-tert-butyl-1,3-dioxoisoindol-2-yl)ethyl]-3-hydroxy-5-[4-(4-methoxyphenyl)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 66676457 |
| Molecular Formula | C32H35NO6 |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | 2-[2-(5-tert-butyl-1,3-dioxoisoindol-2-yl)ethyl]-3-hydroxy-5-[4-(4-methoxyphenyl)phenyl]pentanoic acid |
| SMILES | COc1ccc(-c2ccc(CCC(O)C(CCN3C(=O)c4ccc(C(C)(C)C)cc4C3=O)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C32H35NO6/c1-32(2,3)23-12-15-25-27(19-23)30(36)33(29(25)35)18-17-26(31(37)38)28(34)16-7-20-5-8-21(9-6-20)22-10-13-24(39-4)14-11-22/h5-6,8-15,19,26,28,34H,7,16-18H2,1-4H3,(H,37,38) |
| InChIKey | MQHFBOUREHGLGV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|