C28H24F3NO6 — CID 174552538
2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-hydroxy-5-[4-phenyl-3-(trifluoromethoxy)phenyl]pentanoic acid (PubChem CID 174552538) has the molecular formula C28H24F3NO6 and a molecular weight of 527.50 g/mol. Its IUPAC name is 2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-hydroxy-5-[4-phenyl-3-(trifluoromethoxy)phenyl]pentanoic acid.
| Compound Name | 2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-hydroxy-5-[4-phenyl-3-(trifluoromethoxy)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 174552538 |
| Molecular Formula | C28H24F3NO6 |
| Molecular Weight | 527.50 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | 2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-hydroxy-5-[4-phenyl-3-(trifluoromethoxy)phenyl]pentanoic acid |
| SMILES | O=C(O)C(CCN1C(=O)c2ccccc2C1=O)C(O)CCc1ccc(-c2ccccc2)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C28H24F3NO6/c29-28(30,31)38-24-16-17(10-12-19(24)18-6-2-1-3-7-18)11-13-23(33)22(27(36)37)14-15-32-25(34)20-8-4-5-9-21(20)26(32)35/h1-10,12,16,22-23,33H,11,13-15H2,(H,36,37) |
| InChIKey | XWCDAGOKTZQWKH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|