C28H23F4NO5 — CID 68957278
(2R,3R)-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-5-[4-fluoro-3-[4-(trifluoromethyl)phenyl]phenyl]-3-hydroxypentanoic acid (PubChem CID 68957278) has the molecular formula C28H23F4NO5 and a molecular weight of 529.49 g/mol. Its IUPAC name is (2R,3R)-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-5-[4-fluoro-3-[4-(trifluoromethyl)phenyl]phenyl]-3-hydroxypentanoic acid.
| Compound Name | (2R,3R)-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-5-[4-fluoro-3-[4-(trifluoromethyl)phenyl]phenyl]-3-hydroxypentanoic acid |
|---|---|
| PubChem CID | 68957278 |
| Molecular Formula | C28H23F4NO5 |
| Molecular Weight | 529.49 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | (2R,3R)-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-5-[4-fluoro-3-[4-(trifluoromethyl)phenyl]phenyl]-3-hydroxypentanoic acid |
| SMILES | O=C(O)[C@H](CCN1C(=O)c2ccccc2C1=O)[C@H](O)CCc1ccc(F)c(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C28H23F4NO5/c29-23-11-5-16(15-22(23)17-7-9-18(10-8-17)28(30,31)32)6-12-24(34)21(27(37)38)13-14-33-25(35)19-3-1-2-4-20(19)26(33)36/h1-5,7-11,15,21,24,34H,6,12-14H2,(H,37,38)/t21-,24-/m1/s1 |
| InChIKey | YLXSZFADUSZHKK-ZJSXRUAMSA-N |
| XLogP | 5.19 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.49 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|