C28H27NO6 — CID 68954998
(2R,3R)-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-hydroxy-5-[4-(4-methoxyphenyl)phenyl]pentanoic acid (PubChem CID 68954998) has the molecular formula C28H27NO6 and a molecular weight of 473.53 g/mol. Its IUPAC name is (2R,3R)-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-hydroxy-5-[4-(4-methoxyphenyl)phenyl]pentanoic acid.
| Compound Name | (2R,3R)-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-hydroxy-5-[4-(4-methoxyphenyl)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 68954998 |
| Molecular Formula | C28H27NO6 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | (2R,3R)-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-hydroxy-5-[4-(4-methoxyphenyl)phenyl]pentanoic acid |
| SMILES | COc1ccc(-c2ccc(CC[C@@H](O)[C@@H](CCN3C(=O)c4ccccc4C3=O)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C28H27NO6/c1-35-21-13-11-20(12-14-21)19-9-6-18(7-10-19)8-15-25(30)24(28(33)34)16-17-29-26(31)22-4-2-3-5-23(22)27(29)32/h2-7,9-14,24-25,30H,8,15-17H2,1H3,(H,33,34)/t24-,25-/m1/s1 |
| InChIKey | HOYQBUNROOFWNS-JWQCQUIFSA-N |
| XLogP | 4.04 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|