C31H34N2O6 — CID 11856539
2-[2-(5-tert-butyl-1,3-dioxoisoindol-2-yl)ethyl]-3-hydroxy-5-[4-(6-methoxy-3-pyridinyl)phenyl]pentanoic acid (PubChem CID 11856539) has the molecular formula C31H34N2O6 and a molecular weight of 530.62 g/mol. Its IUPAC name is 2-[2-(5-tert-butyl-1,3-dioxoisoindol-2-yl)ethyl]-3-hydroxy-5-[4-(6-methoxy-3-pyridinyl)phenyl]pentanoic acid.
| Compound Name | 2-[2-(5-tert-butyl-1,3-dioxoisoindol-2-yl)ethyl]-3-hydroxy-5-[4-(6-methoxy-3-pyridinyl)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 11856539 |
| Molecular Formula | C31H34N2O6 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | 2-[2-(5-tert-butyl-1,3-dioxoisoindol-2-yl)ethyl]-3-hydroxy-5-[4-(6-methoxy-3-pyridinyl)phenyl]pentanoic acid |
| SMILES | COc1ccc(-c2ccc(CCC(O)C(CCN3C(=O)c4ccc(C(C)(C)C)cc4C3=O)C(=O)O)cc2)cn1 |
| InChI | InChI=1S/C31H34N2O6/c1-31(2,3)22-11-12-23-25(17-22)29(36)33(28(23)35)16-15-24(30(37)38)26(34)13-7-19-5-8-20(9-6-19)21-10-14-27(39-4)32-18-21/h5-6,8-12,14,17-18,24,26,34H,7,13,15-16H2,1-4H3,(H,37,38) |
| InChIKey | GECALFLTBLHVBN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 117.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|