C27H23ClFNO5 — CID 69245608
5-[4-(3-chloro-4-fluorophenyl)phenyl]-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-hydroxypentanoic acid (PubChem CID 69245608) has the molecular formula C27H23ClFNO5 and a molecular weight of 495.93 g/mol. Its IUPAC name is 5-[4-(3-chloro-4-fluorophenyl)phenyl]-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-hydroxypentanoic acid.
| Compound Name | 5-[4-(3-chloro-4-fluorophenyl)phenyl]-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-hydroxypentanoic acid |
|---|---|
| PubChem CID | 69245608 |
| Molecular Formula | C27H23ClFNO5 |
| Molecular Weight | 495.93 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 5-[4-(3-chloro-4-fluorophenyl)phenyl]-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-hydroxypentanoic acid |
| SMILES | O=C(O)C(CCN1C(=O)c2ccccc2C1=O)C(O)CCc1ccc(-c2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C27H23ClFNO5/c28-22-15-18(10-11-23(22)29)17-8-5-16(6-9-17)7-12-24(31)21(27(34)35)13-14-30-25(32)19-3-1-2-4-20(19)26(30)33/h1-6,8-11,15,21,24,31H,7,12-14H2,(H,34,35) |
| InChIKey | KYHXGSJYWKNFPD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.93 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|