C21H21FN4O7S — CID 18753607
4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)-N-hydroxy-2-[methyl-(4-phenoxyphenyl)sulfonylamino]butanamide (PubChem CID 18753607) has the molecular formula C21H21FN4O7S and a molecular weight of 492.49 g/mol. Its IUPAC name is 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)-N-hydroxy-2-[methyl-(4-phenoxyphenyl)sulfonylamino]butanamide.
| Compound Name | 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)-N-hydroxy-2-[methyl-(4-phenoxyphenyl)sulfonylamino]butanamide |
|---|---|
| PubChem CID | 18753607 |
| Molecular Formula | C21H21FN4O7S |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)-N-hydroxy-2-[methyl-(4-phenoxyphenyl)sulfonylamino]butanamide |
| SMILES | CN(C(CCn1c(=O)[nH]cc(F)c1=O)C(=O)NO)S(=O)(=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C21H21FN4O7S/c1-25(18(19(27)24-30)11-12-26-20(28)17(22)13-23-21(26)29)34(31,32)16-9-7-15(8-10-16)33-14-5-3-2-4-6-14/h2-10,13,18,30H,11-12H2,1H3,(H,23,29)(H,24,27) |
| InChIKey | ZTWWNTOCLQQKTB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 150.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|