C21H20ClFN4O7S — CID 10119104
4-(4-chloro-2,6-dioxo-5H-pyrimidin-1-yl)-2-[[4-(4-fluorophenoxy)phenyl]sulfonyl-methylamino]-N-hydroxybutanamide (PubChem CID 10119104) has the molecular formula C21H20ClFN4O7S and a molecular weight of 526.93 g/mol. Its IUPAC name is 4-(4-chloro-2,6-dioxo-5H-pyrimidin-1-yl)-2-[[4-(4-fluorophenoxy)phenyl]sulfonyl-methylamino]-N-hydroxybutanamide.
| Compound Name | 4-(4-chloro-2,6-dioxo-5H-pyrimidin-1-yl)-2-[[4-(4-fluorophenoxy)phenyl]sulfonyl-methylamino]-N-hydroxybutanamide |
|---|---|
| PubChem CID | 10119104 |
| Molecular Formula | C21H20ClFN4O7S |
| Molecular Weight | 526.93 g/mol |
| Exact Mass | 526.07 |
| IUPAC Name | 4-(4-chloro-2,6-dioxo-5H-pyrimidin-1-yl)-2-[[4-(4-fluorophenoxy)phenyl]sulfonyl-methylamino]-N-hydroxybutanamide |
| SMILES | CN(C(CCN1C(=O)CC(Cl)=NC1=O)C(=O)NO)S(=O)(=O)c1ccc(Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H20ClFN4O7S/c1-26(17(20(29)25-31)10-11-27-19(28)12-18(22)24-21(27)30)35(32,33)16-8-6-15(7-9-16)34-14-4-2-13(23)3-5-14/h2-9,17,31H,10-12H2,1H3,(H,25,29) |
| InChIKey | JBXBGCMIEBRMRP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 145.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.93 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|