C23H28FNO7S — CID 174408638
2-[(3-ethoxy-3-oxopropyl)-[4-(4-fluorophenoxy)phenyl]sulfonylamino]hexanoic acid (PubChem CID 174408638) has the molecular formula C23H28FNO7S and a molecular weight of 481.54 g/mol. Its IUPAC name is 2-[(3-ethoxy-3-oxopropyl)-[4-(4-fluorophenoxy)phenyl]sulfonylamino]hexanoic acid.
| Compound Name | 2-[(3-ethoxy-3-oxopropyl)-[4-(4-fluorophenoxy)phenyl]sulfonylamino]hexanoic acid |
|---|---|
| PubChem CID | 174408638 |
| Molecular Formula | C23H28FNO7S |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 2-[(3-ethoxy-3-oxopropyl)-[4-(4-fluorophenoxy)phenyl]sulfonylamino]hexanoic acid |
| SMILES | CCCCC(C(=O)O)N(CCC(=O)OCC)S(=O)(=O)c1ccc(Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H28FNO7S/c1-3-5-6-21(23(27)28)25(16-15-22(26)31-4-2)33(29,30)20-13-11-19(12-14-20)32-18-9-7-17(24)8-10-18/h7-14,21H,3-6,15-16H2,1-2H3,(H,27,28) |
| InChIKey | KCVKJXHFZLEPPE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |