About ethyl 3-[4-(4-nitrophenoxy)phenyl]propanoate;1-fluoro-4-nitrobenzene
ethyl 3-[4-(4-nitrophenoxy)phenyl]propanoate;1-fluoro-4-nitrobenzene (PubChem CID 159201025) has the molecular formula C23H21FN2O7
and a molecular weight of 456.43 g/mol. Its IUPAC name is ethyl 3-[4-(4-nitrophenoxy)phenyl]propanoate;1-fluoro-4-nitrobenzene.
Molecular Properties
| Compound Name | ethyl 3-[4-(4-nitrophenoxy)phenyl]propanoate;1-fluoro-4-nitrobenzene |
| PubChem CID | 159201025 |
| Molecular Formula | C23H21FN2O7 |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | ethyl 3-[4-(4-nitrophenoxy)phenyl]propanoate;1-fluoro-4-nitrobenzene |
| SMILES | CCOC(=O)CCc1ccc(Oc2ccc([N+](=O)[O-])cc2)cc1.O=[N+]([O-])c1ccc(F)cc1 |
| InChI | InChI=1S/C17H17NO5.C6H4FNO2/c1-2-22-17(19)12-5-13-3-8-15(9-4-13)23-16-10-6-14(7-11-16)18(20)21;7-5-1-3-6(4-2-5)8(9)10/h3-4,6-11H,2,5,12H2,1H3;1-4H |
| InChIKey | KPHGIPBJXINCCC-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 121.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[4-(4-nitrophenoxy)phenyl]propanoate;1-fluoro-4-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[4-(4-nitrophenoxy)phenyl]propanoate;1-fluoro-4-nitrobenzene?
The IUPAC name of ethyl 3-[4-(4-nitrophenoxy)phenyl]propanoate;1-fluoro-4-nitrobenzene (CID 159201025) is ethyl 3-[4-(4-nitrophenoxy)phenyl]propanoate;1-fluoro-4-nitrobenzene.
What is the SMILES notation for ethyl 3-[4-(4-nitrophenoxy)phenyl]propanoate;1-fluoro-4-nitrobenzene?
The canonical SMILES for ethyl 3-[4-(4-nitrophenoxy)phenyl]propanoate;1-fluoro-4-nitrobenzene is CCOC(=O)CCc1ccc(Oc2ccc([N+](=O)[O-])cc2)cc1.O=[N+]([O-])c1ccc(F)cc1.
What is the InChIKey of ethyl 3-[4-(4-nitrophenoxy)phenyl]propanoate;1-fluoro-4-nitrobenzene?
The InChIKey is KPHGIPBJXINCCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO5.C6H4FNO2/c1-2-22-17(19)12-5-13-3-8-15(9-4-13)23-16-10-6-14(7-11-16)18(20)21;7-5-1-3-6(4-2-5)8(9)10/h3-4,6-11H,2,5,12H2,1H3;1-4H.
What are the key properties of ethyl 3-[4-(4-nitrophenoxy)phenyl]propanoate;1-fluoro-4-nitrobenzene?
ethyl 3-[4-(4-nitrophenoxy)phenyl]propanoate;1-fluoro-4-nitrobenzene has a molecular weight of 456.43 g/mol, XLogP of 5.62, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[4-(4-nitrophenoxy)phenyl]propanoate;1-fluoro-4-nitrobenzene is sourced from PubChem (CID 159201025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).