C20H22FNO4 — CID 139720628
ethyl 3-[3-(3-amino-3-oxopropyl)-5-(4-fluorophenoxy)phenyl]propanoate (PubChem CID 139720628) has the molecular formula C20H22FNO4 and a molecular weight of 359.40 g/mol. Its IUPAC name is ethyl 3-[3-(3-amino-3-oxopropyl)-5-(4-fluorophenoxy)phenyl]propanoate.
| Compound Name | ethyl 3-[3-(3-amino-3-oxopropyl)-5-(4-fluorophenoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 139720628 |
| Molecular Formula | C20H22FNO4 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | ethyl 3-[3-(3-amino-3-oxopropyl)-5-(4-fluorophenoxy)phenyl]propanoate |
| SMILES | CCOC(=O)CCc1cc(CCC(N)=O)cc(Oc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H22FNO4/c1-2-25-20(24)10-4-15-11-14(3-9-19(22)23)12-18(13-15)26-17-7-5-16(21)6-8-17/h5-8,11-13H,2-4,9-10H2,1H3,(H2,22,23) |
| InChIKey | CHOKNJPSNUTPAH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |