C23H27FO4 — CID 19962355
ethyl 3-[3-(3-ethoxy-3-oxopropyl)-5-[(4-fluorophenyl)methyl]phenyl]propanoate (PubChem CID 19962355) has the molecular formula C23H27FO4 and a molecular weight of 386.46 g/mol. Its IUPAC name is ethyl 3-[3-(3-ethoxy-3-oxopropyl)-5-[(4-fluorophenyl)methyl]phenyl]propanoate.
| Compound Name | ethyl 3-[3-(3-ethoxy-3-oxopropyl)-5-[(4-fluorophenyl)methyl]phenyl]propanoate |
|---|---|
| PubChem CID | 19962355 |
| Molecular Formula | C23H27FO4 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | ethyl 3-[3-(3-ethoxy-3-oxopropyl)-5-[(4-fluorophenyl)methyl]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1cc(CCC(=O)OCC)cc(Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H27FO4/c1-3-27-22(25)11-7-18-14-19(8-12-23(26)28-4-2)16-20(15-18)13-17-5-9-21(24)10-6-17/h5-6,9-10,14-16H,3-4,7-8,11-13H2,1-2H3 |
| InChIKey | KRZAGQIXIFXEPO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |