C18H20FNO4S — CID 50891887
ethyl 2-(N-(4-fluorophenyl)sulfonyl-3,5-dimethylanilino)acetate (PubChem CID 50891887) has the molecular formula C18H20FNO4S and a molecular weight of 365.43 g/mol. Its IUPAC name is ethyl 2-(N-(4-fluorophenyl)sulfonyl-3,5-dimethylanilino)acetate.
| Compound Name | ethyl 2-(N-(4-fluorophenyl)sulfonyl-3,5-dimethylanilino)acetate |
|---|---|
| PubChem CID | 50891887 |
| Molecular Formula | C18H20FNO4S |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | ethyl 2-(N-(4-fluorophenyl)sulfonyl-3,5-dimethylanilino)acetate |
| SMILES | CCOC(=O)CN(c1cc(C)cc(C)c1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H20FNO4S/c1-4-24-18(21)12-20(16-10-13(2)9-14(3)11-16)25(22,23)17-7-5-15(19)6-8-17/h5-11H,4,12H2,1-3H3 |
| InChIKey | GRXHINBYCXJSIV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |