C24H32ClN3O5S2 — CID 20683107
(3R)-2-[[4-(4-chlorophenoxy)phenyl]sulfonyl-methylamino]-N-hydroxy-3-[(1-methylpiperidin-4-yl)methylsulfanyl]butanamide (PubChem CID 20683107) has the molecular formula C24H32ClN3O5S2 and a molecular weight of 542.12 g/mol. Its IUPAC name is (3R)-2-[[4-(4-chlorophenoxy)phenyl]sulfonyl-methylamino]-N-hydroxy-3-[(1-methylpiperidin-4-yl)methylsulfanyl]butanamide.
| Compound Name | (3R)-2-[[4-(4-chlorophenoxy)phenyl]sulfonyl-methylamino]-N-hydroxy-3-[(1-methylpiperidin-4-yl)methylsulfanyl]butanamide |
|---|---|
| PubChem CID | 20683107 |
| Molecular Formula | C24H32ClN3O5S2 |
| Molecular Weight | 542.12 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | (3R)-2-[[4-(4-chlorophenoxy)phenyl]sulfonyl-methylamino]-N-hydroxy-3-[(1-methylpiperidin-4-yl)methylsulfanyl]butanamide |
| SMILES | C[C@@H](SCC1CCN(C)CC1)C(C(=O)NO)N(C)S(=O)(=O)c1ccc(Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H32ClN3O5S2/c1-17(34-16-18-12-14-27(2)15-13-18)23(24(29)26-30)28(3)35(31,32)22-10-8-21(9-11-22)33-20-6-4-19(25)5-7-20/h4-11,17-18,23,30H,12-16H2,1-3H3,(H,26,29)/t17-,23?/m1/s1 |
| InChIKey | VSMKKRZZEUPPQJ-LIXIDFRTSA-N |
| XLogP | 4.09 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.12 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|