C16H22N2O5S — CID 10132821
2-[(4-buta-2,3-dienoxyphenyl)sulfonyl-methylamino]-N-hydroxy-3-methylbutanamide (PubChem CID 10132821) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is 2-[(4-buta-2,3-dienoxyphenyl)sulfonyl-methylamino]-N-hydroxy-3-methylbutanamide.
| Compound Name | 2-[(4-buta-2,3-dienoxyphenyl)sulfonyl-methylamino]-N-hydroxy-3-methylbutanamide |
|---|---|
| PubChem CID | 10132821 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-[(4-buta-2,3-dienoxyphenyl)sulfonyl-methylamino]-N-hydroxy-3-methylbutanamide |
| SMILES | C=C=CCOc1ccc(S(=O)(=O)N(C)C(C(=O)NO)C(C)C)cc1 |
| InChI | InChI=1S/C16H22N2O5S/c1-5-6-11-23-13-7-9-14(10-8-13)24(21,22)18(4)15(12(2)3)16(19)17-20/h6-10,12,15,20H,1,11H2,2-4H3,(H,17,19) |
| InChIKey | YUELYEUMPBPPER-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|