C15H20N2O5S — CID 91802615
1-buta-2,3-dienoxy-4-[[1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-sulfinoamino]benzene (PubChem CID 91802615) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is 1-buta-2,3-dienoxy-4-[[1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-sulfinoamino]benzene.
| Compound Name | 1-buta-2,3-dienoxy-4-[[1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-sulfinoamino]benzene |
|---|---|
| PubChem CID | 91802615 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 1-buta-2,3-dienoxy-4-[[1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-sulfinoamino]benzene |
| SMILES | C=C=CCOc1ccc(N(C(C(=O)NO)C(C)C)S(=O)O)cc1 |
| InChI | InChI=1S/C15H20N2O5S/c1-4-5-10-22-13-8-6-12(7-9-13)17(23(20)21)14(11(2)3)15(18)16-19/h5-9,11,14,19H,1,10H2,2-3H3,(H,16,18)(H,20,21) |
| InChIKey | XOQKDGUQUHWBLV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|