C25H25INO5S- — CID 91805778
1-iodo-2-[[4-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)-sulfinatoamino]phenyl]phenoxy]methyl]benzene (PubChem CID 91805778) has the molecular formula C25H25INO5S- and a molecular weight of 578.45 g/mol. Its IUPAC name is 1-iodo-2-[[4-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)-sulfinatoamino]phenyl]phenoxy]methyl]benzene.
| Compound Name | 1-iodo-2-[[4-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)-sulfinatoamino]phenyl]phenoxy]methyl]benzene |
|---|---|
| PubChem CID | 91805778 |
| Molecular Formula | C25H25INO5S- |
| Molecular Weight | 578.45 g/mol |
| Exact Mass | 578.05 |
| IUPAC Name | 1-iodo-2-[[4-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)-sulfinatoamino]phenyl]phenoxy]methyl]benzene |
| SMILES | COC(=O)C(C(C)C)N(c1ccc(-c2ccc(OCc3ccccc3I)cc2)cc1)S(=O)[O-] |
| InChI | InChI=1S/C25H26INO5S/c1-17(2)24(25(28)31-3)27(33(29)30)21-12-8-18(9-13-21)19-10-14-22(15-11-19)32-16-20-6-4-5-7-23(20)26/h4-15,17,24H,16H2,1-3H3,(H,29,30)/p-1 |
| InChIKey | UYWSTCXRODLIPO-UHFFFAOYSA-M |
| XLogP | 5.34 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.45 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|