C27H25NO7S2-2 — CID 91226442
1-benzofuran-2-yl-[4-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)-sulfinatoamino]phenyl]phenyl]methanesulfinate (PubChem CID 91226442) has the molecular formula C27H25NO7S2-2 and a molecular weight of 539.63 g/mol. Its IUPAC name is 1-benzofuran-2-yl-[4-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)-sulfinatoamino]phenyl]phenyl]methanesulfinate.
| Compound Name | 1-benzofuran-2-yl-[4-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)-sulfinatoamino]phenyl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 91226442 |
| Molecular Formula | C27H25NO7S2-2 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.11 |
| IUPAC Name | 1-benzofuran-2-yl-[4-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)-sulfinatoamino]phenyl]phenyl]methanesulfinate |
| SMILES | COC(=O)C(C(C)C)N(c1ccc(-c2ccc(C(c3cc4ccccc4o3)S(=O)[O-])cc2)cc1)S(=O)[O-] |
| InChI | InChI=1S/C27H27NO7S2/c1-17(2)25(27(29)34-3)28(37(32)33)22-14-12-19(13-15-22)18-8-10-20(11-9-18)26(36(30)31)24-16-21-6-4-5-7-23(21)35-24/h4-17,25-26H,1-3H3,(H,30,31)(H,32,33)/p-2 |
| InChIKey | PACSSQPVUHUVRE-UHFFFAOYSA-L |
| XLogP | 4.87 |
| TPSA | 122.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|