C26H25N3O5S2 — CID 90936834
2-[[4-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)-sulfinoamino]phenyl]phenyl]carbamoyl]-1,3-benzothiazole (PubChem CID 90936834) has the molecular formula C26H25N3O5S2 and a molecular weight of 523.64 g/mol. Its IUPAC name is 2-[[4-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)-sulfinoamino]phenyl]phenyl]carbamoyl]-1,3-benzothiazole.
| Compound Name | 2-[[4-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)-sulfinoamino]phenyl]phenyl]carbamoyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 90936834 |
| Molecular Formula | C26H25N3O5S2 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | 2-[[4-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)-sulfinoamino]phenyl]phenyl]carbamoyl]-1,3-benzothiazole |
| SMILES | COC(=O)C(C(C)C)N(c1ccc(-c2ccc(NC(=O)c3nc4ccccc4s3)cc2)cc1)S(=O)O |
| InChI | InChI=1S/C26H25N3O5S2/c1-16(2)23(26(31)34-3)29(36(32)33)20-14-10-18(11-15-20)17-8-12-19(13-9-17)27-24(30)25-28-21-6-4-5-7-22(21)35-25/h4-16,23H,1-3H3,(H,27,30)(H,32,33) |
| InChIKey | PEGJNABAZPYFBK-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|