C33H31N3O8S2 — CID 91048623
2-[4-[4-[[4-(benzenesulfonamido)-3-methyl-1-benzofuran-2-carbonyl]amino]phenyl]-N-sulfinoanilino]-3-methylbutanoic acid (PubChem CID 91048623) has the molecular formula C33H31N3O8S2 and a molecular weight of 661.76 g/mol. Its IUPAC name is 2-[4-[4-[[4-(benzenesulfonamido)-3-methyl-1-benzofuran-2-carbonyl]amino]phenyl]-N-sulfinoanilino]-3-methylbutanoic acid.
| Compound Name | 2-[4-[4-[[4-(benzenesulfonamido)-3-methyl-1-benzofuran-2-carbonyl]amino]phenyl]-N-sulfinoanilino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 91048623 |
| Molecular Formula | C33H31N3O8S2 |
| Molecular Weight | 661.76 g/mol |
| Exact Mass | 661.16 |
| IUPAC Name | 2-[4-[4-[[4-(benzenesulfonamido)-3-methyl-1-benzofuran-2-carbonyl]amino]phenyl]-N-sulfinoanilino]-3-methylbutanoic acid |
| SMILES | Cc1c(C(=O)Nc2ccc(-c3ccc(N(C(C(=O)O)C(C)C)S(=O)O)cc3)cc2)oc2cccc(NS(=O)(=O)c3ccccc3)c12 |
| InChI | InChI=1S/C33H31N3O8S2/c1-20(2)30(33(38)39)36(45(40)41)25-18-14-23(15-19-25)22-12-16-24(17-13-22)34-32(37)31-21(3)29-27(10-7-11-28(29)44-31)35-46(42,43)26-8-5-4-6-9-26/h4-20,30,35H,1-3H3,(H,34,37)(H,38,39)(H,40,41) |
| InChIKey | BWEIWFISQUWJOW-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 166.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.76 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|