C32H32N3O6S- — CID 91805637
2-[[4-[4-[(1-carboxy-2-methylpropyl)-sulfinatoamino]phenyl]phenyl]carbamoyl]-4-[3-(dimethylamino)prop-1-ynyl]-3-methyl-1-benzofuran (PubChem CID 91805637) has the molecular formula C32H32N3O6S- and a molecular weight of 586.69 g/mol. Its IUPAC name is 2-[[4-[4-[(1-carboxy-2-methylpropyl)-sulfinatoamino]phenyl]phenyl]carbamoyl]-4-[3-(dimethylamino)prop-1-ynyl]-3-methyl-1-benzofuran.
| Compound Name | 2-[[4-[4-[(1-carboxy-2-methylpropyl)-sulfinatoamino]phenyl]phenyl]carbamoyl]-4-[3-(dimethylamino)prop-1-ynyl]-3-methyl-1-benzofuran |
|---|---|
| PubChem CID | 91805637 |
| Molecular Formula | C32H32N3O6S- |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.20 |
| IUPAC Name | 2-[[4-[4-[(1-carboxy-2-methylpropyl)-sulfinatoamino]phenyl]phenyl]carbamoyl]-4-[3-(dimethylamino)prop-1-ynyl]-3-methyl-1-benzofuran |
| SMILES | Cc1c(C(=O)Nc2ccc(-c3ccc(N(C(C(=O)O)C(C)C)S(=O)[O-])cc3)cc2)oc2cccc(C#CCN(C)C)c12 |
| InChI | InChI=1S/C32H33N3O6S/c1-20(2)29(32(37)38)35(42(39)40)26-17-13-23(14-18-26)22-11-15-25(16-12-22)33-31(36)30-21(3)28-24(9-7-19-34(4)5)8-6-10-27(28)41-30/h6,8,10-18,20,29H,19H2,1-5H3,(H,33,36)(H,37,38)(H,39,40)/p-1 |
| InChIKey | RFKGYCUAUHTGJA-UHFFFAOYSA-M |
| XLogP | 5.28 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|