C15H15NO3 — CID 68715594
4-[3-(dimethylamino)prop-1-ynyl]-3-methyl-1-benzofuran-2-carboxylic acid (PubChem CID 68715594) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is 4-[3-(dimethylamino)prop-1-ynyl]-3-methyl-1-benzofuran-2-carboxylic acid.
| Compound Name | 4-[3-(dimethylamino)prop-1-ynyl]-3-methyl-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 68715594 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 4-[3-(dimethylamino)prop-1-ynyl]-3-methyl-1-benzofuran-2-carboxylic acid |
| SMILES | Cc1c(C(=O)O)oc2cccc(C#CCN(C)C)c12 |
| InChI | InChI=1S/C15H15NO3/c1-10-13-11(7-5-9-16(2)3)6-4-8-12(13)19-14(10)15(17)18/h4,6,8H,9H2,1-3H3,(H,17,18) |
| InChIKey | NXEXSNZJIDYSGJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|