C15H14O4 — CID 68715077
ethyl 4-(3-hydroxyprop-1-ynyl)-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 68715077) has the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. Its IUPAC name is ethyl 4-(3-hydroxyprop-1-ynyl)-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 4-(3-hydroxyprop-1-ynyl)-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 68715077 |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | ethyl 4-(3-hydroxyprop-1-ynyl)-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2cccc(C#CCO)c2c1C |
| InChI | InChI=1S/C15H14O4/c1-3-18-15(17)14-10(2)13-11(7-5-9-16)6-4-8-12(13)19-14/h4,6,8,16H,3,9H2,1-2H3 |
| InChIKey | USCNJTYYHJDCAO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|