C19H28O4Si — CID 68711986
ethyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 68711986) has the molecular formula C19H28O4Si and a molecular weight of 348.52 g/mol. Its IUPAC name is ethyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 68711986 |
| Molecular Formula | C19H28O4Si |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | ethyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2cccc(CO[Si](C)(C)C(C)(C)C)c2c1C |
| InChI | InChI=1S/C19H28O4Si/c1-8-21-18(20)17-13(2)16-14(10-9-11-15(16)23-17)12-22-24(6,7)19(3,4)5/h9-11H,8,12H2,1-7H3 |
| InChIKey | CNTYKAGESCJMID-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|