C27H28O9 — CID 21156197
ethyl 4-[3-[(2-ethoxycarbonyl-3-methyl-1-benzofuran-4-yl)peroxy]-2-hydroxypropyl]-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 21156197) has the molecular formula C27H28O9 and a molecular weight of 496.51 g/mol. Its IUPAC name is ethyl 4-[3-[(2-ethoxycarbonyl-3-methyl-1-benzofuran-4-yl)peroxy]-2-hydroxypropyl]-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 4-[3-[(2-ethoxycarbonyl-3-methyl-1-benzofuran-4-yl)peroxy]-2-hydroxypropyl]-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 21156197 |
| Molecular Formula | C27H28O9 |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | ethyl 4-[3-[(2-ethoxycarbonyl-3-methyl-1-benzofuran-4-yl)peroxy]-2-hydroxypropyl]-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2cccc(CC(O)COOc3cccc4oc(C(=O)OCC)c(C)c34)c2c1C |
| InChI | InChI=1S/C27H28O9/c1-5-31-26(29)24-15(3)22-17(9-7-10-19(22)34-24)13-18(28)14-33-36-21-12-8-11-20-23(21)16(4)25(35-20)27(30)32-6-2/h7-12,18,28H,5-6,13-14H2,1-4H3 |
| InChIKey | MOFAJPZZVACAIQ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 117.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|