C22H26N2O4 — CID 510561
ethyl 3-methyl-4-[3-(2-pyridin-3-ylethylamino)propoxy]-1-benzofuran-2-carboxylate (PubChem CID 510561) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is ethyl 3-methyl-4-[3-(2-pyridin-3-ylethylamino)propoxy]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 3-methyl-4-[3-(2-pyridin-3-ylethylamino)propoxy]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 510561 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | ethyl 3-methyl-4-[3-(2-pyridin-3-ylethylamino)propoxy]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2cccc(OCCCNCCc3cccnc3)c2c1C |
| InChI | InChI=1S/C22H26N2O4/c1-3-26-22(25)21-16(2)20-18(8-4-9-19(20)28-21)27-14-6-12-23-13-10-17-7-5-11-24-15-17/h4-5,7-9,11,15,23H,3,6,10,12-14H2,1-2H3 |
| InChIKey | CSDFPNRSGFWPAY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|