C21H31NO4 — CID 57151671
ethyl 4-[3-(2-methylpropylamino)propoxy]-3-propyl-1-benzofuran-2-carboxylate (PubChem CID 57151671) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is ethyl 4-[3-(2-methylpropylamino)propoxy]-3-propyl-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 4-[3-(2-methylpropylamino)propoxy]-3-propyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 57151671 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | ethyl 4-[3-(2-methylpropylamino)propoxy]-3-propyl-1-benzofuran-2-carboxylate |
| SMILES | CCCc1c(C(=O)OCC)oc2cccc(OCCCNCC(C)C)c12 |
| InChI | InChI=1S/C21H31NO4/c1-5-9-16-19-17(25-13-8-12-22-14-15(3)4)10-7-11-18(19)26-20(16)21(23)24-6-2/h7,10-11,15,22H,5-6,8-9,12-14H2,1-4H3 |
| InChIKey | XNTZTSVFGZIGCQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|