C16H22ClN3O4 — CID 68655867
ethyl 4-[3-(diaminomethylideneamino)propoxy]-3-methyl-1-benzofuran-2-carboxylate;hydrochloride (PubChem CID 68655867) has the molecular formula C16H22ClN3O4 and a molecular weight of 355.82 g/mol. Its IUPAC name is ethyl 4-[3-(diaminomethylideneamino)propoxy]-3-methyl-1-benzofuran-2-carboxylate;hydrochloride.
| Compound Name | ethyl 4-[3-(diaminomethylideneamino)propoxy]-3-methyl-1-benzofuran-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 68655867 |
| Molecular Formula | C16H22ClN3O4 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | ethyl 4-[3-(diaminomethylideneamino)propoxy]-3-methyl-1-benzofuran-2-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1oc2cccc(OCCCN=C(N)N)c2c1C.Cl |
| InChI | InChI=1S/C16H21N3O4.ClH/c1-3-21-15(20)14-10(2)13-11(6-4-7-12(13)23-14)22-9-5-8-19-16(17)18;/h4,6-7H,3,5,8-9H2,1-2H3,(H4,17,18,19);1H |
| InChIKey | FNFAPPSVXWBZTF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 113.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|