C14H17N3O — CID 95456191
2-(3-naphthalen-1-yloxypropyl)guanidine (PubChem CID 95456191) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 2-(3-naphthalen-1-yloxypropyl)guanidine.
| Compound Name | 2-(3-naphthalen-1-yloxypropyl)guanidine |
|---|---|
| PubChem CID | 95456191 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 2-(3-naphthalen-1-yloxypropyl)guanidine |
| SMILES | NC(N)=NCCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C14H17N3O/c15-14(16)17-9-4-10-18-13-8-3-6-11-5-1-2-7-12(11)13/h1-3,5-8H,4,9-10H2,(H4,15,16,17) |
| InChIKey | ZONWEPWMOIRUIJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|