C25H28N4O4 — CID 68655897
2-[3-methyl-4-[3-(pyridin-3-ylmethylamino)propoxy]-1-benzofuran-2-yl]-N-propan-2-yl-1,3-oxazole-4-carboxamide (PubChem CID 68655897) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is 2-[3-methyl-4-[3-(pyridin-3-ylmethylamino)propoxy]-1-benzofuran-2-yl]-N-propan-2-yl-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[3-methyl-4-[3-(pyridin-3-ylmethylamino)propoxy]-1-benzofuran-2-yl]-N-propan-2-yl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 68655897 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 2-[3-methyl-4-[3-(pyridin-3-ylmethylamino)propoxy]-1-benzofuran-2-yl]-N-propan-2-yl-1,3-oxazole-4-carboxamide |
| SMILES | Cc1c(-c2nc(C(=O)NC(C)C)co2)oc2cccc(OCCCNCc3cccnc3)c12 |
| InChI | InChI=1S/C25H28N4O4/c1-16(2)28-24(30)19-15-32-25(29-19)23-17(3)22-20(8-4-9-21(22)33-23)31-12-6-11-27-14-18-7-5-10-26-13-18/h4-5,7-10,13,15-16,27H,6,11-12,14H2,1-3H3,(H,28,30) |
| InChIKey | PHCVBYJSFJLZJA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|