C30H32N2O5 — CID 22615075
2-[5-[[3-methyl-4-[3-(pyridin-3-ylmethylamino)propoxy]-1-benzofuran-2-yl]methoxy]-1-benzofuran-2-yl]propan-2-ol (PubChem CID 22615075) has the molecular formula C30H32N2O5 and a molecular weight of 500.60 g/mol. Its IUPAC name is 2-[5-[[3-methyl-4-[3-(pyridin-3-ylmethylamino)propoxy]-1-benzofuran-2-yl]methoxy]-1-benzofuran-2-yl]propan-2-ol.
| Compound Name | 2-[5-[[3-methyl-4-[3-(pyridin-3-ylmethylamino)propoxy]-1-benzofuran-2-yl]methoxy]-1-benzofuran-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 22615075 |
| Molecular Formula | C30H32N2O5 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | 2-[5-[[3-methyl-4-[3-(pyridin-3-ylmethylamino)propoxy]-1-benzofuran-2-yl]methoxy]-1-benzofuran-2-yl]propan-2-ol |
| SMILES | Cc1c(COc2ccc3oc(C(C)(C)O)cc3c2)oc2cccc(OCCCNCc3cccnc3)c12 |
| InChI | InChI=1S/C30H32N2O5/c1-20-27(19-35-23-10-11-24-22(15-23)16-28(37-24)30(2,3)33)36-26-9-4-8-25(29(20)26)34-14-6-13-32-18-21-7-5-12-31-17-21/h4-5,7-12,15-17,32-33H,6,13-14,18-19H2,1-3H3 |
| InChIKey | OELKWCREEWEJAL-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 89.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|