C25H23F3N2O3 — CID 22614968
3-[[3-methyl-2-[(2,4,6-trifluorophenoxy)methyl]-1-benzofuran-4-yl]oxy]-N-(pyridin-3-ylmethyl)propan-1-amine (PubChem CID 22614968) has the molecular formula C25H23F3N2O3 and a molecular weight of 456.46 g/mol. Its IUPAC name is 3-[[3-methyl-2-[(2,4,6-trifluorophenoxy)methyl]-1-benzofuran-4-yl]oxy]-N-(pyridin-3-ylmethyl)propan-1-amine.
| Compound Name | 3-[[3-methyl-2-[(2,4,6-trifluorophenoxy)methyl]-1-benzofuran-4-yl]oxy]-N-(pyridin-3-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 22614968 |
| Molecular Formula | C25H23F3N2O3 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 3-[[3-methyl-2-[(2,4,6-trifluorophenoxy)methyl]-1-benzofuran-4-yl]oxy]-N-(pyridin-3-ylmethyl)propan-1-amine |
| SMILES | Cc1c(COc2c(F)cc(F)cc2F)oc2cccc(OCCCNCc3cccnc3)c12 |
| InChI | InChI=1S/C25H23F3N2O3/c1-16-23(15-32-25-19(27)11-18(26)12-20(25)28)33-22-7-2-6-21(24(16)22)31-10-4-9-30-14-17-5-3-8-29-13-17/h2-3,5-8,11-13,30H,4,9-10,14-15H2,1H3 |
| InChIKey | XIISIJINCXIEGE-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|