C25H23F3N2O3 — CID 68655535
4-[[3-methyl-2-[(2,3,5-trifluorophenoxy)methyl]-1-benzofuran-4-yl]oxy]-1-pyridin-3-ylbutan-1-amine (PubChem CID 68655535) has the molecular formula C25H23F3N2O3 and a molecular weight of 456.46 g/mol. Its IUPAC name is 4-[[3-methyl-2-[(2,3,5-trifluorophenoxy)methyl]-1-benzofuran-4-yl]oxy]-1-pyridin-3-ylbutan-1-amine.
| Compound Name | 4-[[3-methyl-2-[(2,3,5-trifluorophenoxy)methyl]-1-benzofuran-4-yl]oxy]-1-pyridin-3-ylbutan-1-amine |
|---|---|
| PubChem CID | 68655535 |
| Molecular Formula | C25H23F3N2O3 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 4-[[3-methyl-2-[(2,3,5-trifluorophenoxy)methyl]-1-benzofuran-4-yl]oxy]-1-pyridin-3-ylbutan-1-amine |
| SMILES | Cc1c(COc2cc(F)cc(F)c2F)oc2cccc(OCCCC(N)c3cccnc3)c12 |
| InChI | InChI=1S/C25H23F3N2O3/c1-15-23(14-32-22-12-17(26)11-18(27)25(22)28)33-21-8-2-7-20(24(15)21)31-10-4-6-19(29)16-5-3-9-30-13-16/h2-3,5,7-9,11-13,19H,4,6,10,14,29H2,1H3 |
| InChIKey | SUCMQNNZPHCFNK-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|