C16H15NO5S2 — CID 68715917
2-ethoxycarbonyl-3-methyl-4-[sulfino(thiophen-2-yl)amino]-1-benzofuran (PubChem CID 68715917) has the molecular formula C16H15NO5S2 and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-ethoxycarbonyl-3-methyl-4-[sulfino(thiophen-2-yl)amino]-1-benzofuran.
| Compound Name | 2-ethoxycarbonyl-3-methyl-4-[sulfino(thiophen-2-yl)amino]-1-benzofuran |
|---|---|
| PubChem CID | 68715917 |
| Molecular Formula | C16H15NO5S2 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 2-ethoxycarbonyl-3-methyl-4-[sulfino(thiophen-2-yl)amino]-1-benzofuran |
| SMILES | CCOC(=O)c1oc2cccc(N(c3cccs3)S(=O)O)c2c1C |
| InChI | InChI=1S/C16H15NO5S2/c1-3-21-16(18)15-10(2)14-11(6-4-7-12(14)22-15)17(24(19)20)13-8-5-9-23-13/h4-9H,3H2,1-2H3,(H,19,20) |
| InChIKey | KQQUPNCWKKDUDJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|