C12H15N — CID 34243612
N,N-dimethyl-3-(2-methylphenyl)prop-2-yn-1-amine (PubChem CID 34243612) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is N,N-dimethyl-3-(2-methylphenyl)prop-2-yn-1-amine.
| Compound Name | N,N-dimethyl-3-(2-methylphenyl)prop-2-yn-1-amine |
|---|---|
| PubChem CID | 34243612 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | N,N-dimethyl-3-(2-methylphenyl)prop-2-yn-1-amine |
| SMILES | Cc1ccccc1C#CCN(C)C |
| InChI | InChI=1S/C12H15N/c1-11-7-4-5-8-12(11)9-6-10-13(2)3/h4-5,7-8H,10H2,1-3H3 |
| InChIKey | KAMUFWHEGHLVGX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|