C32H31N2O7S- — CID 91525160
2-[[4-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)-sulfinatoamino]phenyl]phenyl]carbamoyl]-4-(3-methoxyprop-1-ynyl)-3-methyl-1-benzofuran (PubChem CID 91525160) has the molecular formula C32H31N2O7S- and a molecular weight of 587.67 g/mol. Its IUPAC name is 2-[[4-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)-sulfinatoamino]phenyl]phenyl]carbamoyl]-4-(3-methoxyprop-1-ynyl)-3-methyl-1-benzofuran.
| Compound Name | 2-[[4-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)-sulfinatoamino]phenyl]phenyl]carbamoyl]-4-(3-methoxyprop-1-ynyl)-3-methyl-1-benzofuran |
|---|---|
| PubChem CID | 91525160 |
| Molecular Formula | C32H31N2O7S- |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 587.19 |
| IUPAC Name | 2-[[4-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)-sulfinatoamino]phenyl]phenyl]carbamoyl]-4-(3-methoxyprop-1-ynyl)-3-methyl-1-benzofuran |
| SMILES | COCC#Cc1cccc2oc(C(=O)Nc3ccc(-c4ccc(N(C(C(=O)OC)C(C)C)S(=O)[O-])cc4)cc3)c(C)c12 |
| InChI | InChI=1S/C32H32N2O7S/c1-20(2)29(32(36)40-5)34(42(37)38)26-17-13-23(14-18-26)22-11-15-25(16-12-22)33-31(35)30-21(3)28-24(9-7-19-39-4)8-6-10-27(28)41-30/h6,8,10-18,20,29H,19H2,1-5H3,(H,33,35)(H,37,38)/p-1 |
| InChIKey | ZQHYOOLGUBTOLT-UHFFFAOYSA-M |
| XLogP | 5.46 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|