C30H32N2O7S — CID 91547135
2-[4-[4-[[4-(3-hydroxypropyl)-3-methyl-1-benzofuran-2-carbonyl]amino]phenyl]-N-sulfinoanilino]-3-methylbutanoic acid (PubChem CID 91547135) has the molecular formula C30H32N2O7S and a molecular weight of 564.66 g/mol. Its IUPAC name is 2-[4-[4-[[4-(3-hydroxypropyl)-3-methyl-1-benzofuran-2-carbonyl]amino]phenyl]-N-sulfinoanilino]-3-methylbutanoic acid.
| Compound Name | 2-[4-[4-[[4-(3-hydroxypropyl)-3-methyl-1-benzofuran-2-carbonyl]amino]phenyl]-N-sulfinoanilino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 91547135 |
| Molecular Formula | C30H32N2O7S |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | 2-[4-[4-[[4-(3-hydroxypropyl)-3-methyl-1-benzofuran-2-carbonyl]amino]phenyl]-N-sulfinoanilino]-3-methylbutanoic acid |
| SMILES | Cc1c(C(=O)Nc2ccc(-c3ccc(N(C(C(=O)O)C(C)C)S(=O)O)cc3)cc2)oc2cccc(CCCO)c12 |
| InChI | InChI=1S/C30H32N2O7S/c1-18(2)27(30(35)36)32(40(37)38)24-15-11-21(12-16-24)20-9-13-23(14-10-20)31-29(34)28-19(3)26-22(7-5-17-33)6-4-8-25(26)39-28/h4,6,8-16,18,27,33H,5,7,17H2,1-3H3,(H,31,34)(H,35,36)(H,37,38) |
| InChIKey | IKMNQPIMLCNSTN-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 140.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|