C24H24N2O6S — CID 67110804
3-methyl-2-[4-[4-(phenylcarbamoyloxy)phenyl]-N-sulfinoanilino]butanoic acid (PubChem CID 67110804) has the molecular formula C24H24N2O6S and a molecular weight of 468.53 g/mol. Its IUPAC name is 3-methyl-2-[4-[4-(phenylcarbamoyloxy)phenyl]-N-sulfinoanilino]butanoic acid.
| Compound Name | 3-methyl-2-[4-[4-(phenylcarbamoyloxy)phenyl]-N-sulfinoanilino]butanoic acid |
|---|---|
| PubChem CID | 67110804 |
| Molecular Formula | C24H24N2O6S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 3-methyl-2-[4-[4-(phenylcarbamoyloxy)phenyl]-N-sulfinoanilino]butanoic acid |
| SMILES | CC(C)C(C(=O)O)N(c1ccc(-c2ccc(OC(=O)Nc3ccccc3)cc2)cc1)S(=O)O |
| InChI | InChI=1S/C24H24N2O6S/c1-16(2)22(23(27)28)26(33(30)31)20-12-8-17(9-13-20)18-10-14-21(15-11-18)32-24(29)25-19-6-4-3-5-7-19/h3-16,22H,1-2H3,(H,25,29)(H,27,28)(H,30,31) |
| InChIKey | LGFQHMNHDPAPMO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|