About [4-(dimethylamino)-3-propan-2-ylphenyl] N-phenylcarbamate;iodomethane
[4-(dimethylamino)-3-propan-2-ylphenyl] N-phenylcarbamate;iodomethane (PubChem CID 23621709) has the molecular formula C19H25IN2O2
and a molecular weight of 440.33 g/mol. Its IUPAC name is [4-(dimethylamino)-3-propan-2-ylphenyl] N-phenylcarbamate;iodomethane.
Molecular Properties
| Compound Name | [4-(dimethylamino)-3-propan-2-ylphenyl] N-phenylcarbamate;iodomethane |
| PubChem CID | 23621709 |
| Molecular Formula | C19H25IN2O2 |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | [4-(dimethylamino)-3-propan-2-ylphenyl] N-phenylcarbamate;iodomethane |
| SMILES | CC(C)c1cc(OC(=O)Nc2ccccc2)ccc1N(C)C.CI |
| InChI | InChI=1S/C18H22N2O2.CH3I/c1-13(2)16-12-15(10-11-17(16)20(3)4)22-18(21)19-14-8-6-5-7-9-14;1-2/h5-13H,1-4H3,(H,19,21);1H3 |
| InChIKey | XVFVHESAHPSEOW-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [4-(dimethylamino)-3-propan-2-ylphenyl] N-phenylcarbamate;iodomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(dimethylamino)-3-propan-2-ylphenyl] N-phenylcarbamate;iodomethane?
The IUPAC name of [4-(dimethylamino)-3-propan-2-ylphenyl] N-phenylcarbamate;iodomethane (CID 23621709) is [4-(dimethylamino)-3-propan-2-ylphenyl] N-phenylcarbamate;iodomethane.
What is the SMILES notation for [4-(dimethylamino)-3-propan-2-ylphenyl] N-phenylcarbamate;iodomethane?
The canonical SMILES for [4-(dimethylamino)-3-propan-2-ylphenyl] N-phenylcarbamate;iodomethane is CC(C)c1cc(OC(=O)Nc2ccccc2)ccc1N(C)C.CI.
What is the InChIKey of [4-(dimethylamino)-3-propan-2-ylphenyl] N-phenylcarbamate;iodomethane?
The InChIKey is XVFVHESAHPSEOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O2.CH3I/c1-13(2)16-12-15(10-11-17(16)20(3)4)22-18(21)19-14-8-6-5-7-9-14;1-2/h5-13H,1-4H3,(H,19,21);1H3.
What are the key properties of [4-(dimethylamino)-3-propan-2-ylphenyl] N-phenylcarbamate;iodomethane?
[4-(dimethylamino)-3-propan-2-ylphenyl] N-phenylcarbamate;iodomethane has a molecular weight of 440.33 g/mol, XLogP of 5.54, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(dimethylamino)-3-propan-2-ylphenyl] N-phenylcarbamate;iodomethane is sourced from PubChem (CID 23621709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).