C24H24N2O2 — CID 86659883
(1-phenyl-2,3-dihydroindol-5-yl) N-(4-propan-2-ylphenyl)carbamate (PubChem CID 86659883) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is (1-phenyl-2,3-dihydroindol-5-yl) N-(4-propan-2-ylphenyl)carbamate.
| Compound Name | (1-phenyl-2,3-dihydroindol-5-yl) N-(4-propan-2-ylphenyl)carbamate |
|---|---|
| PubChem CID | 86659883 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (1-phenyl-2,3-dihydroindol-5-yl) N-(4-propan-2-ylphenyl)carbamate |
| SMILES | CC(C)c1ccc(NC(=O)Oc2ccc3c(c2)CCN3c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24N2O2/c1-17(2)18-8-10-20(11-9-18)25-24(27)28-22-12-13-23-19(16-22)14-15-26(23)21-6-4-3-5-7-21/h3-13,16-17H,14-15H2,1-2H3,(H,25,27) |
| InChIKey | UGRPQFAQOMVGGW-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |