C36H39N3O2 — CID 46880287
[(3aR,8bS)-3-(2,2-diphenylethyl)-4,8b-dimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-(4-propan-2-ylphenyl)carbamate (PubChem CID 46880287) has the molecular formula C36H39N3O2 and a molecular weight of 545.73 g/mol. Its IUPAC name is [(3aR,8bS)-3-(2,2-diphenylethyl)-4,8b-dimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-(4-propan-2-ylphenyl)carbamate.
| Compound Name | [(3aR,8bS)-3-(2,2-diphenylethyl)-4,8b-dimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-(4-propan-2-ylphenyl)carbamate |
|---|---|
| PubChem CID | 46880287 |
| Molecular Formula | C36H39N3O2 |
| Molecular Weight | 545.73 g/mol |
| Exact Mass | 545.30 |
| IUPAC Name | [(3aR,8bS)-3-(2,2-diphenylethyl)-4,8b-dimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-(4-propan-2-ylphenyl)carbamate |
| SMILES | CC(C)c1ccc(NC(=O)Oc2ccc3c(c2)[C@]2(C)CCN(CC(c4ccccc4)c4ccccc4)[C@@H]2N3C)cc1 |
| InChI | InChI=1S/C36H39N3O2/c1-25(2)26-15-17-29(18-16-26)37-35(40)41-30-19-20-33-32(23-30)36(3)21-22-39(34(36)38(33)4)24-31(27-11-7-5-8-12-27)28-13-9-6-10-14-28/h5-20,23,25,31,34H,21-22,24H2,1-4H3,(H,37,40)/t34-,36-/m0/s1 |
| InChIKey | KNGAQMBDICLRPO-GIWKVKTRSA-N |
| XLogP | 7.99 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.73 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |