C27H29N3O3 — CID 10503416
[(3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-(4-phenylmethoxyphenyl)carbamate (PubChem CID 10503416) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is [(3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-(4-phenylmethoxyphenyl)carbamate.
| Compound Name | [(3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-(4-phenylmethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 10503416 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | [(3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-(4-phenylmethoxyphenyl)carbamate |
| SMILES | CN1CC[C@@]2(C)c3cc(OC(=O)Nc4ccc(OCc5ccccc5)cc4)ccc3N(C)[C@@H]12 |
| InChI | InChI=1S/C27H29N3O3/c1-27-15-16-29(2)25(27)30(3)24-14-13-22(17-23(24)27)33-26(31)28-20-9-11-21(12-10-20)32-18-19-7-5-4-6-8-19/h4-14,17,25H,15-16,18H2,1-3H3,(H,28,31)/t25-,27+/m1/s1 |
| InChIKey | KRUXSUGLXMAWLZ-VPUSJEBWSA-N |
| XLogP | 5.25 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |