C19H27N3O6 — CID 18642591
oxalic acid;propyl N-[(3aS,8bR)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl]carbamate (PubChem CID 18642591) has the molecular formula C19H27N3O6 and a molecular weight of 393.44 g/mol. Its IUPAC name is oxalic acid;propyl N-[(3aS,8bR)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl]carbamate.
| Compound Name | oxalic acid;propyl N-[(3aS,8bR)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl]carbamate |
|---|---|
| PubChem CID | 18642591 |
| Molecular Formula | C19H27N3O6 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | oxalic acid;propyl N-[(3aS,8bR)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl]carbamate |
| SMILES | CCCOC(=O)Nc1ccc2c(c1)[C@@]1(C)CCN(C)[C@H]1N2C.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H25N3O2.C2H2O4/c1-5-10-22-16(21)18-12-6-7-14-13(11-12)17(2)8-9-19(3)15(17)20(14)4;3-1(4)2(5)6/h6-7,11,15H,5,8-10H2,1-4H3,(H,18,21);(H,3,4)(H,5,6)/t15-,17+;/m0./s1 |
| InChIKey | LHPYGWBBKMSUNP-KPVRICSOSA-N |
| XLogP | 2.17 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|