C33H41N3O3 — CID 46880681
[(3aR,8bS)-4,8b-dimethyl-3-(2-phenylethyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-(4-hexoxyphenyl)carbamate (PubChem CID 46880681) has the molecular formula C33H41N3O3 and a molecular weight of 527.71 g/mol. Its IUPAC name is [(3aR,8bS)-4,8b-dimethyl-3-(2-phenylethyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-(4-hexoxyphenyl)carbamate.
| Compound Name | [(3aR,8bS)-4,8b-dimethyl-3-(2-phenylethyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-(4-hexoxyphenyl)carbamate |
|---|---|
| PubChem CID | 46880681 |
| Molecular Formula | C33H41N3O3 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.31 |
| IUPAC Name | [(3aR,8bS)-4,8b-dimethyl-3-(2-phenylethyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-(4-hexoxyphenyl)carbamate |
| SMILES | CCCCCCOc1ccc(NC(=O)Oc2ccc3c(c2)[C@]2(C)CCN(CCc4ccccc4)[C@@H]2N3C)cc1 |
| InChI | InChI=1S/C33H41N3O3/c1-4-5-6-10-23-38-27-15-13-26(14-16-27)34-32(37)39-28-17-18-30-29(24-28)33(2)20-22-36(31(33)35(30)3)21-19-25-11-8-7-9-12-25/h7-9,11-18,24,31H,4-6,10,19-23H2,1-3H3,(H,34,37)/t31-,33-/m0/s1 |
| InChIKey | GOORNMPSDKZVPT-WEZIJMHWSA-N |
| XLogP | 7.24 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|