C33H31N2O6S- — CID 90740150
4-(2-cyclopropylethynyl)-2-[[4-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)-sulfinatoamino]phenyl]phenyl]carbamoyl]-3-methyl-1-benzofuran (PubChem CID 90740150) has the molecular formula C33H31N2O6S- and a molecular weight of 583.69 g/mol. Its IUPAC name is 4-(2-cyclopropylethynyl)-2-[[4-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)-sulfinatoamino]phenyl]phenyl]carbamoyl]-3-methyl-1-benzofuran.
| Compound Name | 4-(2-cyclopropylethynyl)-2-[[4-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)-sulfinatoamino]phenyl]phenyl]carbamoyl]-3-methyl-1-benzofuran |
|---|---|
| PubChem CID | 90740150 |
| Molecular Formula | C33H31N2O6S- |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.19 |
| IUPAC Name | 4-(2-cyclopropylethynyl)-2-[[4-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)-sulfinatoamino]phenyl]phenyl]carbamoyl]-3-methyl-1-benzofuran |
| SMILES | COC(=O)C(C(C)C)N(c1ccc(-c2ccc(NC(=O)c3oc4cccc(C#CC5CC5)c4c3C)cc2)cc1)S(=O)[O-] |
| InChI | InChI=1S/C33H32N2O6S/c1-20(2)30(33(37)40-4)35(42(38)39)27-18-14-24(15-19-27)23-12-16-26(17-13-23)34-32(36)31-21(3)29-25(11-10-22-8-9-22)6-5-7-28(29)41-31/h5-7,12-20,22,30H,8-9H2,1-4H3,(H,34,36)(H,38,39)/p-1 |
| InChIKey | PGIYEVFZTIAGTF-UHFFFAOYSA-M |
| XLogP | 6.22 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|