C26H25NO7S2 — CID 91031256
2-[4-[4-[1-benzofuran-2-yl(sulfino)methyl]phenyl]-N-sulfinoanilino]-3-methylbutanoic acid (PubChem CID 91031256) has the molecular formula C26H25NO7S2 and a molecular weight of 527.62 g/mol. Its IUPAC name is 2-[4-[4-[1-benzofuran-2-yl(sulfino)methyl]phenyl]-N-sulfinoanilino]-3-methylbutanoic acid.
| Compound Name | 2-[4-[4-[1-benzofuran-2-yl(sulfino)methyl]phenyl]-N-sulfinoanilino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 91031256 |
| Molecular Formula | C26H25NO7S2 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | 2-[4-[4-[1-benzofuran-2-yl(sulfino)methyl]phenyl]-N-sulfinoanilino]-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)N(c1ccc(-c2ccc(C(c3cc4ccccc4o3)S(=O)O)cc2)cc1)S(=O)O |
| InChI | InChI=1S/C26H25NO7S2/c1-16(2)24(26(28)29)27(36(32)33)21-13-11-18(12-14-21)17-7-9-19(10-8-17)25(35(30)31)23-15-20-5-3-4-6-22(20)34-23/h3-16,24-25H,1-2H3,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | WPPHGBWZDZCCQX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|