C14H15NO4 — CID 55049773
3-[1-(1-benzofuran-2-yl)ethyl-methylamino]-3-oxopropanoic acid (PubChem CID 55049773) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 3-[1-(1-benzofuran-2-yl)ethyl-methylamino]-3-oxopropanoic acid.
| Compound Name | 3-[1-(1-benzofuran-2-yl)ethyl-methylamino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 55049773 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 3-[1-(1-benzofuran-2-yl)ethyl-methylamino]-3-oxopropanoic acid |
| SMILES | CC(c1cc2ccccc2o1)N(C)C(=O)CC(=O)O |
| InChI | InChI=1S/C14H15NO4/c1-9(15(2)13(16)8-14(17)18)12-7-10-5-3-4-6-11(10)19-12/h3-7,9H,8H2,1-2H3,(H,17,18) |
| InChIKey | BGDCGWGUQAVFFT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|