C16H22N2O4S — CID 97251479
N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-3-(dimethylsulfamoyl)-N-methylpropanamide (PubChem CID 97251479) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-3-(dimethylsulfamoyl)-N-methylpropanamide.
| Compound Name | N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-3-(dimethylsulfamoyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 97251479 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-3-(dimethylsulfamoyl)-N-methylpropanamide |
| SMILES | C[C@@H](c1cc2ccccc2o1)N(C)C(=O)CCS(=O)(=O)N(C)C |
| InChI | InChI=1S/C16H22N2O4S/c1-12(15-11-13-7-5-6-8-14(13)22-15)18(4)16(19)9-10-23(20,21)17(2)3/h5-8,11-12H,9-10H2,1-4H3/t12-/m0/s1 |
| InChIKey | AZEVBUDIQLXWBE-LBPRGKRZSA-N |
| XLogP | 2.23 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |